Ответы и объяснения

2013-03-18T11:50:22+00:00

CH3-CH(CH3)-CH2-CH2I+KOH=CH3-CH(CH3)-CH=CH2+KI+H2O

CH3-CH(CH3)-CH=CH2+HI=CH3-CH(CH3)-CHI-CH3

CH3-CH(CH3)-CHI-CH3+KOH=CH3-C(CH3)=CH-CH3+KI+H2O

CH3-C=CH-CH3+KMnO4=CH3-COH-CH-CH3+MnO2+KOH

          |                                                 |           |

       CH3                                          CH3     OH